C34H35GeN2+ — CID 171459403
trimethyl-[9-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-4-yl]carbazol-2-yl]germane (PubChem CID 171459403) has the molecular formula C34H35GeN2+ and a molecular weight of 544.28 g/mol. Its IUPAC name is trimethyl-[9-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-4-yl]carbazol-2-yl]germane.
| Compound Name | trimethyl-[9-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-4-yl]carbazol-2-yl]germane |
|---|---|
| PubChem CID | 171459403 |
| Molecular Formula | C34H35GeN2+ |
| Molecular Weight | 544.28 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | trimethyl-[9-[1-methyl-2-(2,3,5-trimethylphenyl)quinolin-1-ium-4-yl]carbazol-2-yl]germane |
| SMILES | Cc1cc(C)c(C)c(-c2cc(-n3c4ccccc4c4ccc([Ge](C)(C)C)cc43)c3ccccc3[n+]2C)c1 |
| InChI | InChI=1S/C34H35GeN2/c1-22-18-23(2)24(3)29(19-22)32-21-34(28-13-9-10-14-30(28)36(32)7)37-31-15-11-8-12-26(31)27-17-16-25(20-33(27)37)35(4,5)6/h8-21H,1-7H3/q+1 |
| InChIKey | FCFFDWOMPXWMKW-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.28 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|