C37H29N2O+ — CID 171458896
9-[2-(2,3-dimethyldibenzofuran-4-yl)-1,6-dimethylquinolin-1-ium-4-yl]carbazole (PubChem CID 171458896) has the molecular formula C37H29N2O+ and a molecular weight of 517.65 g/mol. Its IUPAC name is 9-[2-(2,3-dimethyldibenzofuran-4-yl)-1,6-dimethylquinolin-1-ium-4-yl]carbazole.
| Compound Name | 9-[2-(2,3-dimethyldibenzofuran-4-yl)-1,6-dimethylquinolin-1-ium-4-yl]carbazole |
|---|---|
| PubChem CID | 171458896 |
| Molecular Formula | C37H29N2O+ |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 9-[2-(2,3-dimethyldibenzofuran-4-yl)-1,6-dimethylquinolin-1-ium-4-yl]carbazole |
| SMILES | Cc1ccc2c(c1)c(-n1c3ccccc3c3ccccc31)cc(-c1c(C)c(C)cc3c1oc1ccccc13)[n+]2C |
| InChI | InChI=1S/C37H29N2O/c1-22-17-18-30-29(19-22)33(39-31-14-8-5-11-25(31)26-12-6-9-15-32(26)39)21-34(38(30)4)36-24(3)23(2)20-28-27-13-7-10-16-35(27)40-37(28)36/h5-21H,1-4H3/q+1 |
| InChIKey | RIZXOZVLZPYAFE-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|