C31H36NOSi+ — CID 164807728
[2-(2,3-dimethyldibenzofuran-4-yl)-1-methyl-6-(2-methylpropyl)quinolin-1-ium-4-yl]-trimethylsilane (PubChem CID 164807728) has the molecular formula C31H36NOSi+ and a molecular weight of 466.72 g/mol. Its IUPAC name is [2-(2,3-dimethyldibenzofuran-4-yl)-1-methyl-6-(2-methylpropyl)quinolin-1-ium-4-yl]-trimethylsilane.
| Compound Name | [2-(2,3-dimethyldibenzofuran-4-yl)-1-methyl-6-(2-methylpropyl)quinolin-1-ium-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 164807728 |
| Molecular Formula | C31H36NOSi+ |
| Molecular Weight | 466.72 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | [2-(2,3-dimethyldibenzofuran-4-yl)-1-methyl-6-(2-methylpropyl)quinolin-1-ium-4-yl]-trimethylsilane |
| SMILES | Cc1cc2c(oc3ccccc32)c(-c2cc([Si](C)(C)C)c3cc(CC(C)C)ccc3[n+]2C)c1C |
| InChI | InChI=1S/C31H36NOSi/c1-19(2)15-22-13-14-26-25(17-22)29(34(6,7)8)18-27(32(26)5)30-21(4)20(3)16-24-23-11-9-10-12-28(23)33-31(24)30/h9-14,16-19H,15H2,1-8H3/q+1 |
| InChIKey | MHYHIXNZMCUMTG-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.72 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|