C32H35N2OSi+ — CID 164807959
[7-tert-butyl-2-(7-isocyano-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-4-yl]-trimethylsilane (PubChem CID 164807959) has the molecular formula C32H35N2OSi+ and a molecular weight of 491.73 g/mol. Its IUPAC name is [7-tert-butyl-2-(7-isocyano-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-4-yl]-trimethylsilane.
| Compound Name | [7-tert-butyl-2-(7-isocyano-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 164807959 |
| Molecular Formula | C32H35N2OSi+ |
| Molecular Weight | 491.73 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | [7-tert-butyl-2-(7-isocyano-2,3-dimethyldibenzofuran-4-yl)-1-methylquinolin-1-ium-4-yl]-trimethylsilane |
| SMILES | [C-]#[N+]c1ccc2c(c1)oc1c(-c3cc([Si](C)(C)C)c4ccc(C(C)(C)C)cc4[n+]3C)c(C)c(C)cc12 |
| InChI | InChI=1S/C32H35N2OSi/c1-19-15-25-23-14-12-22(33-6)17-28(23)35-31(25)30(20(19)2)27-18-29(36(8,9)10)24-13-11-21(32(3,4)5)16-26(24)34(27)7/h11-18H,1-5,7-10H3/q+1 |
| InChIKey | XMUHRQKCHAAYAU-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.73 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|