C25H25N2O+ — CID 164777793
2-deuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)-6-(7-isocyano-3-methyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 164777793) has the molecular formula C25H25N2O+ and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-deuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)-6-(7-isocyano-3-methyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-deuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)-6-(7-isocyano-3-methyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 164777793 |
| Molecular Formula | C25H25N2O+ |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-deuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)-6-(7-isocyano-3-methyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | [2H]c1cc(C([2H])([2H])C(C)(C)C)cc(-c2c(C)ccc3c2oc2cc([N+]#[C-])ccc23)[n+]1C |
| InChI | InChI=1S/C25H25N2O/c1-16-7-9-20-19-10-8-18(26-5)14-22(19)28-24(20)23(16)21-13-17(11-12-27(21)6)15-25(2,3)4/h7-14H,15H2,1-4,6H3/q+1/i12D,15D2 |
| InChIKey | WWNNRDFKKCYNBY-KIPOAWFKSA-N |
| XLogP | 6.53 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|