C32H31N2O+ — CID 162505994
4-deuterio-5-(1,1-dideuterio-2,2-dimethylpropyl)-2-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 162505994) has the molecular formula C32H31N2O+ and a molecular weight of 462.63 g/mol. Its IUPAC name is 4-deuterio-5-(1,1-dideuterio-2,2-dimethylpropyl)-2-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 4-deuterio-5-(1,1-dideuterio-2,2-dimethylpropyl)-2-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 162505994 |
| Molecular Formula | C32H31N2O+ |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 4-deuterio-5-(1,1-dideuterio-2,2-dimethylpropyl)-2-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]c1cc(-c2c(C)ccc3c2oc2c(-c4ccc(C)cc4)c([N+]#[C-])ccc23)[n+](C)cc1C([2H])([2H])C(C)(C)C |
| InChI | InChI=1S/C32H31N2O/c1-20-8-12-23(13-9-20)29-26(33-6)16-15-25-24-14-10-21(2)28(30(24)35-31(25)29)27-17-11-22(19-34(27)7)18-32(3,4)5/h8-17,19H,18H2,1-5,7H3/q+1/i11D,18D2 |
| InChIKey | HATUOAZMDMAXKR-HLFXEUKNSA-N |
| XLogP | 8.50 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|