C28H23N2O+ — CID 163626429
3,4-dideuterio-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 163626429) has the molecular formula C28H23N2O+ and a molecular weight of 408.54 g/mol. Its IUPAC name is 3,4-dideuterio-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 3,4-dideuterio-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 163626429 |
| Molecular Formula | C28H23N2O+ |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 3,4-dideuterio-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]c1c([2H])c(-c2c(C)ccc3c2oc2c(-c4ccccc4)c([N+]#[C-])ccc23)[n+](C)c(C)c1C([2H])([2H])[2H] |
| InChI | InChI=1S/C28H23N2O/c1-17-12-16-24(30(5)19(17)3)25-18(2)11-13-21-22-14-15-23(29-4)26(28(22)31-27(21)25)20-9-7-6-8-10-20/h6-16H,1-3,5H3/q+1/i1D3,12D,16D |
| InChIKey | DXIIZSZTFCKCOF-WSNNHXAISA-N |
| XLogP | 7.22 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|