C32H31N2O+ — CID 163804878
3-deuterio-4-(1,1-dideuterio-2-methylpropyl)-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 163804878) has the molecular formula C32H31N2O+ and a molecular weight of 465.65 g/mol. Its IUPAC name is 3-deuterio-4-(1,1-dideuterio-2-methylpropyl)-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 3-deuterio-4-(1,1-dideuterio-2-methylpropyl)-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 163804878 |
| Molecular Formula | C32H31N2O+ |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 3-deuterio-4-(1,1-dideuterio-2-methylpropyl)-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]c1c(C([2H])([2H])C(C)C)c(C([2H])([2H])[2H])c(C)[n+](C)c1-c1c(C)ccc2c1oc1c(-c3ccccc3)c([N+]#[C-])ccc12 |
| InChI | InChI=1S/C32H31N2O/c1-19(2)17-24-18-28(34(7)22(5)21(24)4)29-20(3)13-14-25-26-15-16-27(33-6)30(32(26)35-31(25)29)23-11-9-8-10-12-23/h8-16,18-19H,17H2,1-5,7H3/q+1/i4D3,17D2,18D |
| InChIKey | GLSPMCCAYGCAOL-ACNMQFLASA-N |
| XLogP | 8.42 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|