C27H29N2O+ — CID 163747269
3-deuterio-4-(1,1-dideuterio-2-methylpropyl)-2-(7-isocyano-1,3-dimethyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 163747269) has the molecular formula C27H29N2O+ and a molecular weight of 403.58 g/mol. Its IUPAC name is 3-deuterio-4-(1,1-dideuterio-2-methylpropyl)-2-(7-isocyano-1,3-dimethyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 3-deuterio-4-(1,1-dideuterio-2-methylpropyl)-2-(7-isocyano-1,3-dimethyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 163747269 |
| Molecular Formula | C27H29N2O+ |
| Molecular Weight | 403.58 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | 3-deuterio-4-(1,1-dideuterio-2-methylpropyl)-2-(7-isocyano-1,3-dimethyldibenzofuran-4-yl)-1,6-dimethyl-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]c1c(C([2H])([2H])C(C)C)c(C([2H])([2H])[2H])c(C)[n+](C)c1-c1c(C)cc(C)c2c1oc1cc([N+]#[C-])ccc12 |
| InChI | InChI=1S/C27H29N2O/c1-15(2)11-20-13-23(29(8)19(6)18(20)5)26-17(4)12-16(3)25-22-10-9-21(28-7)14-24(22)30-27(25)26/h9-10,12-15H,11H2,1-6,8H3/q+1/i5D3,11D2,13D |
| InChIKey | LKQRHFJBUZKNQE-APSCIXSNSA-N |
| XLogP | 7.06 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.58 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|