C25H24FN2O+ — CID 164778692
4-(1,1-dideuterio-2-methylpropyl)-5-fluoro-2-[7-isocyano-3-methyl-9-(trideuteriomethyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 164778692) has the molecular formula C25H24FN2O+ and a molecular weight of 392.51 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2-methylpropyl)-5-fluoro-2-[7-isocyano-3-methyl-9-(trideuteriomethyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 4-(1,1-dideuterio-2-methylpropyl)-5-fluoro-2-[7-isocyano-3-methyl-9-(trideuteriomethyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 164778692 |
| Molecular Formula | C25H24FN2O+ |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 4-(1,1-dideuterio-2-methylpropyl)-5-fluoro-2-[7-isocyano-3-methyl-9-(trideuteriomethyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1cc([N+]#[C-])cc2oc3c(-c4cc(C([2H])([2H])C(C)C)c(F)c[n+]4C)c(C)ccc3c12 |
| InChI | InChI=1S/C25H24FN2O/c1-14(2)9-17-11-21(28(6)13-20(17)26)24-15(3)7-8-19-23-16(4)10-18(27-5)12-22(23)29-25(19)24/h7-8,10-14H,9H2,1-4,6H3/q+1/i4D3,9D2 |
| InChIKey | SYWWABWPSVSCNZ-VVLWYDDRSA-N |
| XLogP | 6.58 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|