C21H16FN2O+ — CID 164778613
4-fluoro-2-(6-isocyano-2-methyldibenzofuran-1-yl)-1-methyl-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 164778613) has the molecular formula C21H16FN2O+ and a molecular weight of 334.39 g/mol. Its IUPAC name is 4-fluoro-2-(6-isocyano-2-methyldibenzofuran-1-yl)-1-methyl-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 4-fluoro-2-(6-isocyano-2-methyldibenzofuran-1-yl)-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 164778613 |
| Molecular Formula | C21H16FN2O+ |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-fluoro-2-(6-isocyano-2-methyldibenzofuran-1-yl)-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3oc4c([N+]#[C-])cccc4c23)cc1F |
| InChI | InChI=1S/C21H16FN2O/c1-12-8-9-18-20(14-6-5-7-16(23-3)21(14)25-18)19(12)17-10-15(22)13(2)11-24(17)4/h5-11H,1-2,4H3/q+1/i2D3 |
| InChIKey | OLDDTHUZNKUIOW-BMSJAHLVSA-N |
| XLogP | 5.38 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|