C22H18FN2O+ — CID 164778695
4-fluoro-2-[6-isocyano-3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium (PubChem CID 164778695) has the molecular formula C22H18FN2O+ and a molecular weight of 351.43 g/mol. Its IUPAC name is 4-fluoro-2-[6-isocyano-3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium.
| Compound Name | 4-fluoro-2-[6-isocyano-3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 164778695 |
| Molecular Formula | C22H18FN2O+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 4-fluoro-2-[6-isocyano-3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]-1-methyl-5-(trideuteriomethyl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)cc(C([2H])([2H])[2H])c3c2oc2c([N+]#[C-])cccc23)cc1F |
| InChI | InChI=1S/C22H18FN2O/c1-12-9-13(2)20(18-10-16(23)14(3)11-25(18)5)22-19(12)15-7-6-8-17(24-4)21(15)26-22/h6-11H,1-3,5H3/q+1/i1D3,3D3 |
| InChIKey | GHPIMRXWJXBXGQ-WTJPRRJNSA-N |
| XLogP | 5.69 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|