C21H14N3O+ — CID 154615732
6-isocyano-3-methyl-4-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile (PubChem CID 154615732) has the molecular formula C21H14N3O+ and a molecular weight of 324.36 g/mol. Its IUPAC name is 6-isocyano-3-methyl-4-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile.
| Compound Name | 6-isocyano-3-methyl-4-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 154615732 |
| Molecular Formula | C21H14N3O+ |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 6-isocyano-3-methyl-4-(1-methylpyridin-1-ium-2-yl)dibenzofuran-1-carbonitrile |
| SMILES | [C-]#[N+]c1cccc2c1oc1c(-c3cccc[n+]3C)c(C)cc(C#N)c12 |
| InChI | InChI=1S/C21H14N3O/c1-13-11-14(12-22)19-15-7-6-8-16(23-2)20(15)25-21(19)18(13)17-9-4-5-10-24(17)3/h4-11H,1,3H3/q+1 |
| InChIKey | WIKYPGTWKWCNAC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 45.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|