C23H21N2O+ — CID 163866357
3,5-dideuterio-2-[6-isocyano-3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]-1,4,6-trimethylpyridin-1-ium (PubChem CID 163866357) has the molecular formula C23H21N2O+ and a molecular weight of 346.46 g/mol. Its IUPAC name is 3,5-dideuterio-2-[6-isocyano-3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]-1,4,6-trimethylpyridin-1-ium.
| Compound Name | 3,5-dideuterio-2-[6-isocyano-3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]-1,4,6-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 163866357 |
| Molecular Formula | C23H21N2O+ |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3,5-dideuterio-2-[6-isocyano-3-methyl-1-(trideuteriomethyl)dibenzofuran-4-yl]-1,4,6-trimethylpyridin-1-ium |
| SMILES | [2H]c1c(C)c([2H])c(-c2c(C)cc(C([2H])([2H])[2H])c3c2oc2c([N+]#[C-])cccc23)[n+](C)c1C |
| InChI | InChI=1S/C23H21N2O/c1-13-10-16(4)25(6)19(11-13)21-15(3)12-14(2)20-17-8-7-9-18(24-5)22(17)26-23(20)21/h7-12H,1-4,6H3/q+1/i2D3,10D,11D |
| InChIKey | LMVXLTIIBCMOQT-AQYZMPKCSA-N |
| XLogP | 5.86 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|