C32H31N2O+ — CID 163894226
3,5-dideuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(6-isocyano-3-methyl-9-phenyldibenzofuran-4-yl)-1,6-dimethylpyridin-1-ium (PubChem CID 163894226) has the molecular formula C32H31N2O+ and a molecular weight of 463.64 g/mol. Its IUPAC name is 3,5-dideuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(6-isocyano-3-methyl-9-phenyldibenzofuran-4-yl)-1,6-dimethylpyridin-1-ium.
| Compound Name | 3,5-dideuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(6-isocyano-3-methyl-9-phenyldibenzofuran-4-yl)-1,6-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 163894226 |
| Molecular Formula | C32H31N2O+ |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | 3,5-dideuterio-4-(1,1-dideuterio-2,2-dimethylpropyl)-2-(6-isocyano-3-methyl-9-phenyldibenzofuran-4-yl)-1,6-dimethylpyridin-1-ium |
| SMILES | [2H]c1c(C([2H])([2H])C(C)(C)C)c([2H])c(-c2c(C)ccc3c2oc2c([N+]#[C-])ccc(-c4ccccc4)c23)[n+](C)c1C |
| InChI | InChI=1S/C32H31N2O/c1-20-13-14-25-29-24(23-11-9-8-10-12-23)15-16-26(33-6)31(29)35-30(25)28(20)27-18-22(19-32(3,4)5)17-21(2)34(27)7/h8-18H,19H2,1-5,7H3/q+1/i17D,18D,19D2 |
| InChIKey | COWKCBLTAMRDRX-BFXQDNMDSA-N |
| XLogP | 8.50 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|