C31H29N2O+ — CID 163956702
3-deuterio-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,4,6-trimethyl-5-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium (PubChem CID 163956702) has the molecular formula C31H29N2O+ and a molecular weight of 450.62 g/mol. Its IUPAC name is 3-deuterio-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,4,6-trimethyl-5-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium.
| Compound Name | 3-deuterio-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,4,6-trimethyl-5-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 163956702 |
| Molecular Formula | C31H29N2O+ |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 3-deuterio-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,4,6-trimethyl-5-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium |
| SMILES | [2H]c1c(C)c(C([2H])(C)C([2H])([2H])[2H])c(C)[n+](C)c1-c1c(C)ccc2c1oc1c(-c3ccccc3)c([N+]#[C-])ccc12 |
| InChI | InChI=1S/C31H29N2O/c1-18(2)27-20(4)17-26(33(7)21(27)5)28-19(3)13-14-23-24-15-16-25(32-6)29(31(24)34-30(23)28)22-11-9-8-10-12-22/h8-18H,1-5,7H3/q+1/i1D3,17D,18D |
| InChIKey | OINJLYCXJAXIHU-RVBNWHGCSA-N |
| XLogP | 8.34 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|