C30H27N2O+ — CID 163503759
3,5-dideuterio-2-[7-isocyano-3-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-1,6-dimethyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium (PubChem CID 163503759) has the molecular formula C30H27N2O+ and a molecular weight of 442.63 g/mol. Its IUPAC name is 3,5-dideuterio-2-[7-isocyano-3-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-1,6-dimethyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium.
| Compound Name | 3,5-dideuterio-2-[7-isocyano-3-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-1,6-dimethyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 163503759 |
| Molecular Formula | C30H27N2O+ |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 3,5-dideuterio-2-[7-isocyano-3-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-1,6-dimethyl-4-(1,1,1,2-tetradeuteriopropan-2-yl)pyridin-1-ium |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([N+]#[C-])ccc3c2oc2c(-c4c([2H])c(C([2H])(C)C([2H])([2H])[2H])c([2H])c(C)[n+]4C)c(C)ccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C30H27N2O/c1-18(2)22-16-20(4)32(6)26(17-22)27-19(3)12-13-23-24-14-15-25(31-5)28(30(24)33-29(23)27)21-10-8-7-9-11-21/h7-18H,1-4,6H3/q+1/i1D3,7D,8D,9D,10D,11D,16D,17D,18D |
| InChIKey | ZWPDYKQZBWECFX-IENOKAETSA-N |
| XLogP | 8.04 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|