C28H31N2O+ — CID 163739012
4-(1,1-dideuterio-2-methylpropyl)-2-[7-isocyano-3-methyl-8-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-4-yl]-1,6-dimethylpyridin-1-ium (PubChem CID 163739012) has the molecular formula C28H31N2O+ and a molecular weight of 417.61 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2-methylpropyl)-2-[7-isocyano-3-methyl-8-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-4-yl]-1,6-dimethylpyridin-1-ium.
| Compound Name | 4-(1,1-dideuterio-2-methylpropyl)-2-[7-isocyano-3-methyl-8-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-4-yl]-1,6-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 163739012 |
| Molecular Formula | C28H31N2O+ |
| Molecular Weight | 417.61 g/mol |
| Exact Mass | 417.28 |
| IUPAC Name | 4-(1,1-dideuterio-2-methylpropyl)-2-[7-isocyano-3-methyl-8-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-4-yl]-1,6-dimethylpyridin-1-ium |
| SMILES | [2H]C([2H])(c1cc(C)[n+](C)c(-c2c(C)ccc3c2oc2cc([N+]#[C-])c(C([2H])(C)C([2H])([2H])[2H])cc23)c1)C(C)C |
| InChI | InChI=1S/C28H31N2O/c1-16(2)11-20-12-19(6)30(8)25(13-20)27-18(5)9-10-21-23-14-22(17(3)4)24(29-7)15-26(23)31-28(21)27/h9-10,12-17H,11H2,1-6,8H3/q+1/i3D3,11D2,17D |
| InChIKey | MMGPFCRVEYJQLL-UARNUVFISA-N |
| XLogP | 7.57 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.61 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|