C23H21N2O+ — CID 159054941
2-[8-isocyano-3-methyl-6-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 159054941) has the molecular formula C23H21N2O+ and a molecular weight of 345.46 g/mol. Its IUPAC name is 2-[8-isocyano-3-methyl-6-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2-[8-isocyano-3-methyl-6-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 159054941 |
| Molecular Formula | C23H21N2O+ |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-[8-isocyano-3-methyl-6-(1,1,1,2-tetradeuteriopropan-2-yl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]C([2H])([2H])C([2H])(C)c1cc([N+]#[C-])cc2c1oc1c(-c3cccc[n+]3C)c(C)ccc12 |
| InChI | InChI=1S/C23H21N2O/c1-14(2)18-12-16(24-4)13-19-17-10-9-15(3)21(23(17)26-22(18)19)20-8-6-7-11-25(20)5/h6-14H,1-3,5H3/q+1/i1D3,14D |
| InChIKey | KLJBDXGNDZSSQT-CZEVESCESA-N |
| XLogP | 6.06 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|