C31H29N2O+ — CID 162505780
4-deuterio-5-(1,1-dideuterio-2-methylpropyl)-2-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 162505780) has the molecular formula C31H29N2O+ and a molecular weight of 448.60 g/mol. Its IUPAC name is 4-deuterio-5-(1,1-dideuterio-2-methylpropyl)-2-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 4-deuterio-5-(1,1-dideuterio-2-methylpropyl)-2-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 162505780 |
| Molecular Formula | C31H29N2O+ |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 4-deuterio-5-(1,1-dideuterio-2-methylpropyl)-2-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]c1cc(-c2c(C)ccc3c2oc2c(-c4ccc(C)cc4)c([N+]#[C-])ccc23)[n+](C)cc1C([2H])([2H])C(C)C |
| InChI | InChI=1S/C31H29N2O/c1-19(2)17-22-10-16-27(33(6)18-22)28-21(4)9-13-24-25-14-15-26(32-5)29(31(25)34-30(24)28)23-11-7-20(3)8-12-23/h7-16,18-19H,17H2,1-4,6H3/q+1/i10D,17D2 |
| InChIKey | OXOZTAPZPYEKDD-IQPGACPPSA-N |
| XLogP | 8.11 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|