C32H29N2O+ — CID 162505922
5-(1-deuteriocyclohexyl)-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 162505922) has the molecular formula C32H29N2O+ and a molecular weight of 458.60 g/mol. Its IUPAC name is 5-(1-deuteriocyclohexyl)-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 5-(1-deuteriocyclohexyl)-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 162505922 |
| Molecular Formula | C32H29N2O+ |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | 5-(1-deuteriocyclohexyl)-2-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | [2H]C1(c2ccc(-c3c(C)ccc4c3oc3c(-c5ccccc5)c([N+]#[C-])ccc34)[n+](C)c2)CCCCC1 |
| InChI | InChI=1S/C32H29N2O/c1-21-14-16-25-26-17-18-27(33-2)30(23-12-8-5-9-13-23)32(26)35-31(25)29(21)28-19-15-24(20-34(28)3)22-10-6-4-7-11-22/h5,8-9,12-20,22H,4,6-7,10-11H2,1,3H3/q+1/i22D |
| InChIKey | LMPQOTJPXWRJHW-JDANMYFYSA-N |
| XLogP | 8.65 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|