C26H25N2O+ — CID 154616125
2,3,4,5-tetradeuterio-6-[6-(1-deuteriocyclohexyl)-7-isocyano-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium (PubChem CID 154616125) has the molecular formula C26H25N2O+ and a molecular weight of 386.53 g/mol. Its IUPAC name is 2,3,4,5-tetradeuterio-6-[6-(1-deuteriocyclohexyl)-7-isocyano-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium.
| Compound Name | 2,3,4,5-tetradeuterio-6-[6-(1-deuteriocyclohexyl)-7-isocyano-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 154616125 |
| Molecular Formula | C26H25N2O+ |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2,3,4,5-tetradeuterio-6-[6-(1-deuteriocyclohexyl)-7-isocyano-3-methyldibenzofuran-4-yl]-1-methylpyridin-1-ium |
| SMILES | [2H]c1c([2H])c([2H])[n+](C)c(-c2c(C)ccc3c2oc2c(C4([2H])CCCCC4)c([N+]#[C-])ccc23)c1[2H] |
| InChI | InChI=1S/C26H25N2O/c1-17-12-13-19-20-14-15-21(27-2)24(18-9-5-4-6-10-18)26(20)29-25(19)23(17)22-11-7-8-16-28(22)3/h7-8,11-16,18H,4-6,9-10H2,1,3H3/q+1/i7D,8D,11D,16D,18D |
| InChIKey | NIUAHIGIYLCUOO-VUKBPHCDSA-N |
| XLogP | 6.98 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|