C27H27N2O+ — CID 154615167
2-(6-cyclohexyl-7-isocyano-1,3-dimethyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 154615167) has the molecular formula C27H27N2O+ and a molecular weight of 395.53 g/mol. Its IUPAC name is 2-(6-cyclohexyl-7-isocyano-1,3-dimethyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(6-cyclohexyl-7-isocyano-1,3-dimethyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 154615167 |
| Molecular Formula | C27H27N2O+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-(6-cyclohexyl-7-isocyano-1,3-dimethyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4cccc[n+]4C)c(C)cc(C)c32)c1C1CCCCC1 |
| InChI | InChI=1S/C27H27N2O/c1-17-16-18(2)24(22-12-8-9-15-29(22)4)27-23(17)20-13-14-21(28-3)25(26(20)30-27)19-10-6-5-7-11-19/h8-9,12-16,19H,5-7,10-11H2,1-2,4H3/q+1 |
| InChIKey | PMMVZYQJQZUSFS-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|