C33H31N2O+ — CID 162505742
4-(cyclopentylmethyl)-2-(7-isocyano-1,3-dimethyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 162505742) has the molecular formula C33H31N2O+ and a molecular weight of 471.62 g/mol. Its IUPAC name is 4-(cyclopentylmethyl)-2-(7-isocyano-1,3-dimethyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 4-(cyclopentylmethyl)-2-(7-isocyano-1,3-dimethyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 162505742 |
| Molecular Formula | C33H31N2O+ |
| Molecular Weight | 471.62 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 4-(cyclopentylmethyl)-2-(7-isocyano-1,3-dimethyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4cc(CC5CCCC5)cc[n+]4C)c(C)cc(C)c32)c1-c1ccccc1 |
| InChI | InChI=1S/C33H31N2O/c1-21-18-22(2)30(28-20-24(16-17-35(28)4)19-23-10-8-9-11-23)33-29(21)26-14-15-27(34-3)31(32(26)36-33)25-12-6-5-7-13-25/h5-7,12-18,20,23H,8-11,19H2,1-2,4H3/q+1 |
| InChIKey | HIAILWFEQMMJSD-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.62 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|