C34H33N2O+ — CID 163577327
3-(cyclopentylmethyl)-6-(7-isocyano-3,8-dimethyl-6-phenyldibenzofuran-4-yl)-1,2-dimethylpyridin-1-ium (PubChem CID 163577327) has the molecular formula C34H33N2O+ and a molecular weight of 485.65 g/mol. Its IUPAC name is 3-(cyclopentylmethyl)-6-(7-isocyano-3,8-dimethyl-6-phenyldibenzofuran-4-yl)-1,2-dimethylpyridin-1-ium.
| Compound Name | 3-(cyclopentylmethyl)-6-(7-isocyano-3,8-dimethyl-6-phenyldibenzofuran-4-yl)-1,2-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 163577327 |
| Molecular Formula | C34H33N2O+ |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | 3-(cyclopentylmethyl)-6-(7-isocyano-3,8-dimethyl-6-phenyldibenzofuran-4-yl)-1,2-dimethylpyridin-1-ium |
| SMILES | [C-]#[N+]c1c(C)cc2c(oc3c(-c4ccc(CC5CCCC5)c(C)[n+]4C)c(C)ccc32)c1-c1ccccc1 |
| InChI | InChI=1S/C34H33N2O/c1-21-15-17-27-28-19-22(2)32(35-4)31(25-13-7-6-8-14-25)34(28)37-33(27)30(21)29-18-16-26(23(3)36(29)5)20-24-11-9-10-12-24/h6-8,13-19,24H,9-12,20H2,1-3,5H3/q+1 |
| InChIKey | YQDGLBRQSWCFGO-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|