C32H31N2O+ — CID 163684194
6-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,2,3-trimethyl-4-(2-methylpropyl)pyridin-1-ium (PubChem CID 163684194) has the molecular formula C32H31N2O+ and a molecular weight of 459.61 g/mol. Its IUPAC name is 6-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,2,3-trimethyl-4-(2-methylpropyl)pyridin-1-ium.
| Compound Name | 6-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,2,3-trimethyl-4-(2-methylpropyl)pyridin-1-ium |
|---|---|
| PubChem CID | 163684194 |
| Molecular Formula | C32H31N2O+ |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 6-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1,2,3-trimethyl-4-(2-methylpropyl)pyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4cc(CC(C)C)c(C)c(C)[n+]4C)c(C)ccc32)c1-c1ccccc1 |
| InChI | InChI=1S/C32H31N2O/c1-19(2)17-24-18-28(34(7)22(5)21(24)4)29-20(3)13-14-25-26-15-16-27(33-6)30(32(26)35-31(25)29)23-11-9-8-10-12-23/h8-16,18-19H,17H2,1-5,7H3/q+1 |
| InChIKey | GLSPMCCAYGCAOL-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|