C32H33N2OSi+ — CID 163830004
[6-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1,2,4-trimethylpyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 163830004) has the molecular formula C32H33N2OSi+ and a molecular weight of 489.72 g/mol. Its IUPAC name is [6-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1,2,4-trimethylpyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [6-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1,2,4-trimethylpyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 163830004 |
| Molecular Formula | C32H33N2OSi+ |
| Molecular Weight | 489.72 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | [6-[7-isocyano-3-methyl-6-(4-methylphenyl)dibenzofuran-4-yl]-1,2,4-trimethylpyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4cc(C)c([Si](C)(C)C)c(C)[n+]4C)c(C)ccc32)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C32H33N2OSi/c1-19-10-13-23(14-11-19)29-26(33-5)17-16-25-24-15-12-20(2)28(30(24)35-31(25)29)27-18-21(3)32(36(7,8)9)22(4)34(27)6/h10-18H,1-4,6-9H3/q+1 |
| InChIKey | CXRPFWCBHCGTRB-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.72 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|