C47H39N2OSi+ — CID 171723658
[6-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1-methyl-4-[4-(4-phenylphenyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 171723658) has the molecular formula C47H39N2OSi+ and a molecular weight of 675.93 g/mol. Its IUPAC name is [6-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1-methyl-4-[4-(4-phenylphenyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [6-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1-methyl-4-[4-(4-phenylphenyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 171723658 |
| Molecular Formula | C47H39N2OSi+ |
| Molecular Weight | 675.93 g/mol |
| Exact Mass | 675.28 |
| IUPAC Name | [6-(7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl)-1-methyl-4-[4-(4-phenylphenyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4cc(-c5ccc(-c6ccc(-c7ccccc7)cc6)cc5)c([Si](C)(C)C)c[n+]4C)c(C)ccc32)c1-c1ccccc1 |
| InChI | InChI=1S/C47H39N2OSi/c1-31-17-26-38-39-27-28-41(48-2)45(37-15-11-8-12-16-37)47(39)50-46(38)44(31)42-29-40(43(30-49(42)3)51(4,5)6)36-24-22-35(23-25-36)34-20-18-33(19-21-34)32-13-9-7-10-14-32/h7-30H,1,3-6H3/q+1 |
| InChIKey | MKICNRDQTNYYLD-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.93 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|