C31H21FN3O+ — CID 169282563
4-fluoro-6-[9-isocyano-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1-methylpyrimidin-1-ium (PubChem CID 169282563) has the molecular formula C31H21FN3O+ and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-fluoro-6-[9-isocyano-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1-methylpyrimidin-1-ium.
| Compound Name | 4-fluoro-6-[9-isocyano-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1-methylpyrimidin-1-ium |
|---|---|
| PubChem CID | 169282563 |
| Molecular Formula | C31H21FN3O+ |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-fluoro-6-[9-isocyano-3-methyl-6-(4-phenylphenyl)dibenzofuran-4-yl]-1-methylpyrimidin-1-ium |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3ccccc3)cc2)c2oc3c(-c4cc(F)nc[n+]4C)c(C)ccc3c12 |
| InChI | InChI=1S/C31H21FN3O/c1-19-9-14-24-29-25(33-2)16-15-23(22-12-10-21(11-13-22)20-7-5-4-6-8-20)30(29)36-31(24)28(19)26-17-27(32)34-18-35(26)3/h4-18H,1,3H3/q+1 |
| InChIKey | QWYQQHOHWHMZCP-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 34.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|