C30H27N2O+ — CID 162505903
2-[7-isocyano-3-methyl-6-(4-propan-2-ylphenyl)dibenzofuran-4-yl]-1,6-dimethylpyridin-1-ium (PubChem CID 162505903) has the molecular formula C30H27N2O+ and a molecular weight of 431.56 g/mol. Its IUPAC name is 2-[7-isocyano-3-methyl-6-(4-propan-2-ylphenyl)dibenzofuran-4-yl]-1,6-dimethylpyridin-1-ium.
| Compound Name | 2-[7-isocyano-3-methyl-6-(4-propan-2-ylphenyl)dibenzofuran-4-yl]-1,6-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 162505903 |
| Molecular Formula | C30H27N2O+ |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[7-isocyano-3-methyl-6-(4-propan-2-ylphenyl)dibenzofuran-4-yl]-1,6-dimethylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4cccc(C)[n+]4C)c(C)ccc32)c1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C30H27N2O/c1-18(2)21-11-13-22(14-12-21)28-25(31-5)17-16-24-23-15-10-19(3)27(29(23)33-30(24)28)26-9-7-8-20(4)32(26)6/h7-18H,1-4,6H3/q+1 |
| InChIKey | ROVPKWMRJKWEKZ-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|