C33H31N2O+ — CID 163615129
3-cyclopentyl-6-[7-isocyano-3-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-1,2,4-trimethylpyridin-1-ium (PubChem CID 163615129) has the molecular formula C33H31N2O+ and a molecular weight of 476.65 g/mol. Its IUPAC name is 3-cyclopentyl-6-[7-isocyano-3-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-1,2,4-trimethylpyridin-1-ium.
| Compound Name | 3-cyclopentyl-6-[7-isocyano-3-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-1,2,4-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 163615129 |
| Molecular Formula | C33H31N2O+ |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 3-cyclopentyl-6-[7-isocyano-3-methyl-6-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-4-yl]-1,2,4-trimethylpyridin-1-ium |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([N+]#[C-])ccc3c2oc2c(-c4cc(C)c(C5CCCC5)c(C)[n+]4C)c(C)ccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C33H31N2O/c1-20-15-16-25-26-17-18-27(34-4)31(24-11-7-6-8-12-24)33(26)36-32(25)30(20)28-19-21(2)29(22(3)35(28)5)23-13-9-10-14-23/h6-8,11-12,15-19,23H,9-10,13-14H2,1-3,5H3/q+1/i6D,7D,8D,11D,12D |
| InChIKey | GYUGTLHGTXZOFX-FQGWPHPPSA-N |
| XLogP | 8.88 |
| TPSA | 21.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|