C33H31N2O+ — CID 163680121
6-(4-cyclopentyl-1,6-dimethylpyridin-1-ium-2-yl)-3,7-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-carbonitrile (PubChem CID 163680121) has the molecular formula C33H31N2O+ and a molecular weight of 476.65 g/mol. Its IUPAC name is 6-(4-cyclopentyl-1,6-dimethylpyridin-1-ium-2-yl)-3,7-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-carbonitrile.
| Compound Name | 6-(4-cyclopentyl-1,6-dimethylpyridin-1-ium-2-yl)-3,7-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-carbonitrile |
|---|---|
| PubChem CID | 163680121 |
| Molecular Formula | C33H31N2O+ |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 6-(4-cyclopentyl-1,6-dimethylpyridin-1-ium-2-yl)-3,7-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-2-carbonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(C)c(C#N)cc3c2oc2c(-c4cc(C5CCCC5)cc(C)[n+]4C)c(C)ccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C33H31N2O/c1-20-14-15-27-28-17-26(19-34)22(3)31(24-12-6-5-7-13-24)33(28)36-32(27)30(20)29-18-25(16-21(2)35(29)4)23-10-8-9-11-23/h5-7,12-18,23H,8-11H2,1-4H3/q+1/i5D,6D,7D,12D,13D |
| InChIKey | PPKUCDXPNRIKJR-LSRHVHRESA-N |
| XLogP | 8.20 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|