C28H23N2O+ — CID 162505967
6-(1,4-dimethylpyridin-1-ium-2-yl)-3,7-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-carbonitrile (PubChem CID 162505967) has the molecular formula C28H23N2O+ and a molecular weight of 408.54 g/mol. Its IUPAC name is 6-(1,4-dimethylpyridin-1-ium-2-yl)-3,7-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-carbonitrile.
| Compound Name | 6-(1,4-dimethylpyridin-1-ium-2-yl)-3,7-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-carbonitrile |
|---|---|
| PubChem CID | 162505967 |
| Molecular Formula | C28H23N2O+ |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 6-(1,4-dimethylpyridin-1-ium-2-yl)-3,7-dimethyl-4-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-carbonitrile |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c(C)cc(C#N)c3c2oc2c(-c4cc(C)cc[n+]4C)c(C)ccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C28H23N2O/c1-17-12-13-30(4)23(14-17)25-18(2)10-11-22-26-21(16-29)15-19(3)24(28(26)31-27(22)25)20-8-6-5-7-9-20/h5-15H,1-4H3/q+1/i5D,6D,7D,8D,9D |
| InChIKey | WYERHSPURPWKDM-CFEWMVNUSA-N |
| XLogP | 6.54 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|