C21H18F2NO+ — CID 146694721
2-(1,7-difluoro-3,6-dimethyldibenzofuran-4-yl)-1,4-dimethylpyridin-1-ium (PubChem CID 146694721) has the molecular formula C21H18F2NO+ and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-(1,7-difluoro-3,6-dimethyldibenzofuran-4-yl)-1,4-dimethylpyridin-1-ium.
| Compound Name | 2-(1,7-difluoro-3,6-dimethyldibenzofuran-4-yl)-1,4-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 146694721 |
| Molecular Formula | C21H18F2NO+ |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(1,7-difluoro-3,6-dimethyldibenzofuran-4-yl)-1,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc[n+](C)c(-c2c(C)cc(F)c3c2oc2c(C)c(F)ccc23)c1 |
| InChI | InChI=1S/C21H18F2NO/c1-11-7-8-24(4)17(9-11)18-12(2)10-16(23)19-14-5-6-15(22)13(3)20(14)25-21(18)19/h5-10H,1-4H3/q+1 |
| InChIKey | UCFBHDVSAOUHPB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|