C23H22F2NO+ — CID 153164988
2-(7,9-difluoro-3,6-dimethyldibenzofuran-4-yl)-1-methyl-4-propan-2-ylpyridin-1-ium (PubChem CID 153164988) has the molecular formula C23H22F2NO+ and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-(7,9-difluoro-3,6-dimethyldibenzofuran-4-yl)-1-methyl-4-propan-2-ylpyridin-1-ium.
| Compound Name | 2-(7,9-difluoro-3,6-dimethyldibenzofuran-4-yl)-1-methyl-4-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 153164988 |
| Molecular Formula | C23H22F2NO+ |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(7,9-difluoro-3,6-dimethyldibenzofuran-4-yl)-1-methyl-4-propan-2-ylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(C)c(F)cc(F)c32)c1-c1cc(C(C)C)cc[n+]1C |
| InChI | InChI=1S/C23H22F2NO/c1-12(2)15-8-9-26(5)19(10-15)20-13(3)6-7-16-21-18(25)11-17(24)14(4)22(21)27-23(16)20/h6-12H,1-5H3/q+1 |
| InChIKey | TUZUWRGYVXAFOM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|