C22H20F2NO+ — CID 153464606
2-(1,7-difluoro-3,6-dimethyldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium (PubChem CID 153464606) has the molecular formula C22H20F2NO+ and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-(1,7-difluoro-3,6-dimethyldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium.
| Compound Name | 2-(1,7-difluoro-3,6-dimethyldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium |
|---|---|
| PubChem CID | 153464606 |
| Molecular Formula | C22H20F2NO+ |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-(1,7-difluoro-3,6-dimethyldibenzofuran-4-yl)-1,4,5-trimethylpyridin-1-ium |
| SMILES | Cc1cc(-c2c(C)cc(F)c3c2oc2c(C)c(F)ccc23)[n+](C)cc1C |
| InChI | InChI=1S/C22H20F2NO/c1-11-9-18(25(5)10-13(11)3)19-12(2)8-17(24)20-15-6-7-16(23)14(4)21(15)26-22(19)20/h6-10H,1-5H3/q+1 |
| InChIKey | RHWFOBATYNBBFS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|