C30H27N2O2+ — CID 171407246
2-(1-tert-butyl-7-isocyano-3-methoxy-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 171407246) has the molecular formula C30H27N2O2+ and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-(1-tert-butyl-7-isocyano-3-methoxy-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(1-tert-butyl-7-isocyano-3-methoxy-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 171407246 |
| Molecular Formula | C30H27N2O2+ |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 2-(1-tert-butyl-7-isocyano-3-methoxy-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4cccc[n+]4C)c(OC)cc(C(C)(C)C)c32)c1-c1ccccc1 |
| InChI | InChI=1S/C30H27N2O2/c1-30(2,3)21-18-24(33-6)27(23-14-10-11-17-32(23)5)29-26(21)20-15-16-22(31-4)25(28(20)34-29)19-12-8-7-9-13-19/h7-18H,1-3,5-6H3/q+1 |
| InChIKey | GAKAEMLRNMAWQW-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 30.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|