C38H28N3+ — CID 165386102
7-isocyano-2-methyl-1-(1-methylpyridin-1-ium-2-yl)-9-phenyl-8-(4-phenylphenyl)carbazole (PubChem CID 165386102) has the molecular formula C38H28N3+ and a molecular weight of 526.66 g/mol. Its IUPAC name is 7-isocyano-2-methyl-1-(1-methylpyridin-1-ium-2-yl)-9-phenyl-8-(4-phenylphenyl)carbazole.
| Compound Name | 7-isocyano-2-methyl-1-(1-methylpyridin-1-ium-2-yl)-9-phenyl-8-(4-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 165386102 |
| Molecular Formula | C38H28N3+ |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 7-isocyano-2-methyl-1-(1-methylpyridin-1-ium-2-yl)-9-phenyl-8-(4-phenylphenyl)carbazole |
| SMILES | [C-]#[N+]c1ccc2c3ccc(C)c(-c4cccc[n+]4C)c3n(-c3ccccc3)c2c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H28N3/c1-26-17-22-31-32-23-24-33(39-2)36(29-20-18-28(19-21-29)27-12-6-4-7-13-27)38(32)41(30-14-8-5-9-15-30)37(31)35(26)34-16-10-11-25-40(34)3/h4-25H,1,3H3/q+1 |
| InChIKey | MRWQZFZFWITXMH-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 13.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|