C26H22FN2+ — CID 167365786
1-fluoro-7,9-dimethyl-8-(1-methylpyridin-1-ium-2-yl)-2-phenylcarbazole (PubChem CID 167365786) has the molecular formula C26H22FN2+ and a molecular weight of 381.47 g/mol. Its IUPAC name is 1-fluoro-7,9-dimethyl-8-(1-methylpyridin-1-ium-2-yl)-2-phenylcarbazole.
| Compound Name | 1-fluoro-7,9-dimethyl-8-(1-methylpyridin-1-ium-2-yl)-2-phenylcarbazole |
|---|---|
| PubChem CID | 167365786 |
| Molecular Formula | C26H22FN2+ |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 1-fluoro-7,9-dimethyl-8-(1-methylpyridin-1-ium-2-yl)-2-phenylcarbazole |
| SMILES | Cc1ccc2c3ccc(-c4ccccc4)c(F)c3n(C)c2c1-c1cccc[n+]1C |
| InChI | InChI=1S/C26H22FN2/c1-17-12-13-20-21-15-14-19(18-9-5-4-6-10-18)24(27)26(21)29(3)25(20)23(17)22-11-7-8-16-28(22)2/h4-16H,1-3H3/q+1 |
| InChIKey | JRSLKJVHHHTKOA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|