C35H29N4O+ — CID 171407178
9-[9-tert-butyl-3-isocyano-7-methyl-6-(1-methylpyrazin-1-ium-2-yl)dibenzofuran-4-yl]carbazole (PubChem CID 171407178) has the molecular formula C35H29N4O+ and a molecular weight of 521.64 g/mol. Its IUPAC name is 9-[9-tert-butyl-3-isocyano-7-methyl-6-(1-methylpyrazin-1-ium-2-yl)dibenzofuran-4-yl]carbazole.
| Compound Name | 9-[9-tert-butyl-3-isocyano-7-methyl-6-(1-methylpyrazin-1-ium-2-yl)dibenzofuran-4-yl]carbazole |
|---|---|
| PubChem CID | 171407178 |
| Molecular Formula | C35H29N4O+ |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 9-[9-tert-butyl-3-isocyano-7-methyl-6-(1-methylpyrazin-1-ium-2-yl)dibenzofuran-4-yl]carbazole |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4cncc[n+]4C)c(C)cc(C(C)(C)C)c32)c1-n1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C35H29N4O/c1-21-19-25(35(2,3)4)31-24-15-16-26(36-5)32(33(24)40-34(31)30(21)29-20-37-17-18-38(29)6)39-27-13-9-7-11-22(27)23-12-8-10-14-28(23)39/h7-20H,1-4,6H3/q+1 |
| InChIKey | AISFJHCNWKQGIY-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 39.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|