C39H34N3O+ — CID 171407234
2-[1-(2,2-dimethylpropyl)-7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl]-1-methyl-3-phenylbenzimidazol-1-ium (PubChem CID 171407234) has the molecular formula C39H34N3O+ and a molecular weight of 560.72 g/mol. Its IUPAC name is 2-[1-(2,2-dimethylpropyl)-7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl]-1-methyl-3-phenylbenzimidazol-1-ium.
| Compound Name | 2-[1-(2,2-dimethylpropyl)-7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl]-1-methyl-3-phenylbenzimidazol-1-ium |
|---|---|
| PubChem CID | 171407234 |
| Molecular Formula | C39H34N3O+ |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 2-[1-(2,2-dimethylpropyl)-7-isocyano-3-methyl-6-phenyldibenzofuran-4-yl]-1-methyl-3-phenylbenzimidazol-1-ium |
| SMILES | [C-]#[N+]c1ccc2c(oc3c(-c4n(-c5ccccc5)c5ccccc5[n+]4C)c(C)cc(CC(C)(C)C)c32)c1-c1ccccc1 |
| InChI | InChI=1S/C39H34N3O/c1-25-23-27(24-39(2,3)4)34-29-21-22-30(40-5)35(26-15-9-7-10-16-26)36(29)43-37(34)33(25)38-41(6)31-19-13-14-20-32(31)42(38)28-17-11-8-12-18-28/h7-23H,24H2,1-4,6H3/q+1 |
| InChIKey | INFAUYYOELAXJR-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 26.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|