C42H34N3O+ — CID 157371218
2-(2,6-dimethyl-4-phenylphenyl)-6-methyl-7-[1-methyl-3-(4-phenylphenyl)benzimidazol-1-ium-2-yl]-1,3-benzoxazole (PubChem CID 157371218) has the molecular formula C42H34N3O+ and a molecular weight of 596.75 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylphenyl)-6-methyl-7-[1-methyl-3-(4-phenylphenyl)benzimidazol-1-ium-2-yl]-1,3-benzoxazole.
| Compound Name | 2-(2,6-dimethyl-4-phenylphenyl)-6-methyl-7-[1-methyl-3-(4-phenylphenyl)benzimidazol-1-ium-2-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 157371218 |
| Molecular Formula | C42H34N3O+ |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.27 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylphenyl)-6-methyl-7-[1-methyl-3-(4-phenylphenyl)benzimidazol-1-ium-2-yl]-1,3-benzoxazole |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1-c1nc2ccc(C)c(-c3n(-c4ccc(-c5ccccc5)cc4)c4ccccc4[n+]3C)c2o1 |
| InChI | InChI=1S/C42H34N3O/c1-27-19-24-35-40(46-41(43-35)38-28(2)25-33(26-29(38)3)31-15-9-6-10-16-31)39(27)42-44(4)36-17-11-12-18-37(36)45(42)34-22-20-32(21-23-34)30-13-7-5-8-14-30/h5-26H,1-4H3/q+1 |
| InChIKey | TVVNPVXLIVGQPO-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|