C32H30N3O+ — CID 159581509
6-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-5-methyl-2-phenyl-1,3-benzoxazole (PubChem CID 159581509) has the molecular formula C32H30N3O+ and a molecular weight of 472.61 g/mol. Its IUPAC name is 6-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-5-methyl-2-phenyl-1,3-benzoxazole.
| Compound Name | 6-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-5-methyl-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 159581509 |
| Molecular Formula | C32H30N3O+ |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 6-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-5-methyl-2-phenyl-1,3-benzoxazole |
| SMILES | Cc1cc2nc(-c3ccccc3)oc2cc1-c1n(-c2ccc(C(C)(C)C)cc2)c2ccccc2[n+]1C |
| InChI | InChI=1S/C32H30N3O/c1-21-19-26-29(36-30(33-26)22-11-7-6-8-12-22)20-25(21)31-34(5)27-13-9-10-14-28(27)35(31)24-17-15-23(16-18-24)32(2,3)4/h6-20H,1-5H3/q+1 |
| InChIKey | AREZGTSYMIVWEY-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|