C40H38N3S+ — CID 161479342
7-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-2-(2,6-dimethyl-4-phenylphenyl)-6-methyl-1,3-benzothiazole (PubChem CID 161479342) has the molecular formula C40H38N3S+ and a molecular weight of 592.83 g/mol. Its IUPAC name is 7-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-2-(2,6-dimethyl-4-phenylphenyl)-6-methyl-1,3-benzothiazole.
| Compound Name | 7-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-2-(2,6-dimethyl-4-phenylphenyl)-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 161479342 |
| Molecular Formula | C40H38N3S+ |
| Molecular Weight | 592.83 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 7-[1-(4-tert-butylphenyl)-3-methylbenzimidazol-3-ium-2-yl]-2-(2,6-dimethyl-4-phenylphenyl)-6-methyl-1,3-benzothiazole |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1-c1nc2ccc(C)c(-c3n(-c4ccc(C(C)(C)C)cc4)c4ccccc4[n+]3C)c2s1 |
| InChI | InChI=1S/C40H38N3S/c1-25-17-22-32-37(44-38(41-32)35-26(2)23-29(24-27(35)3)28-13-9-8-10-14-28)36(25)39-42(7)33-15-11-12-16-34(33)43(39)31-20-18-30(19-21-31)40(4,5)6/h8-24H,1-7H3/q+1 |
| InChIKey | JIJXVMDCOSXCLD-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.83 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|