C40H32N3S+ — CID 162047328
2-(2,6-dimethyl-4-phenylphenyl)-5-methyl-4-(1-methyl-3-naphthalen-1-ylbenzimidazol-1-ium-2-yl)-1,3-benzothiazole (PubChem CID 162047328) has the molecular formula C40H32N3S+ and a molecular weight of 586.78 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylphenyl)-5-methyl-4-(1-methyl-3-naphthalen-1-ylbenzimidazol-1-ium-2-yl)-1,3-benzothiazole.
| Compound Name | 2-(2,6-dimethyl-4-phenylphenyl)-5-methyl-4-(1-methyl-3-naphthalen-1-ylbenzimidazol-1-ium-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 162047328 |
| Molecular Formula | C40H32N3S+ |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylphenyl)-5-methyl-4-(1-methyl-3-naphthalen-1-ylbenzimidazol-1-ium-2-yl)-1,3-benzothiazole |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1-c1nc2c(-c3n(-c4cccc5ccccc45)c4ccccc4[n+]3C)c(C)ccc2s1 |
| InChI | InChI=1S/C40H32N3S/c1-25-21-22-35-38(41-39(44-35)36-26(2)23-30(24-27(36)3)28-13-6-5-7-14-28)37(25)40-42(4)33-18-10-11-19-34(33)43(40)32-20-12-16-29-15-8-9-17-31(29)32/h5-24H,1-4H3/q+1 |
| InChIKey | RGTHYSJOVWZCIV-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|