C34H34N3S+ — CID 161259732
4-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-5-methyl-2-phenyl-1,3-benzothiazole (PubChem CID 161259732) has the molecular formula C34H34N3S+ and a molecular weight of 516.73 g/mol. Its IUPAC name is 4-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-5-methyl-2-phenyl-1,3-benzothiazole.
| Compound Name | 4-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-5-methyl-2-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 161259732 |
| Molecular Formula | C34H34N3S+ |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 4-[1-[2,6-di(propan-2-yl)phenyl]-3-methylbenzimidazol-3-ium-2-yl]-5-methyl-2-phenyl-1,3-benzothiazole |
| SMILES | Cc1ccc2sc(-c3ccccc3)nc2c1-c1n(-c2c(C(C)C)cccc2C(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C34H34N3S/c1-21(2)25-15-12-16-26(22(3)4)32(25)37-28-18-11-10-17-27(28)36(6)34(37)30-23(5)19-20-29-31(30)35-33(38-29)24-13-8-7-9-14-24/h7-22H,1-6H3/q+1 |
| InChIKey | WXYLESMAVUEQSY-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|