C24H30N3S+ — CID 158026318
2-tert-butyl-4-(1-tert-butyl-3-methylbenzimidazol-3-ium-2-yl)-5-methyl-1,3-benzothiazole (PubChem CID 158026318) has the molecular formula C24H30N3S+ and a molecular weight of 392.59 g/mol. Its IUPAC name is 2-tert-butyl-4-(1-tert-butyl-3-methylbenzimidazol-3-ium-2-yl)-5-methyl-1,3-benzothiazole.
| Compound Name | 2-tert-butyl-4-(1-tert-butyl-3-methylbenzimidazol-3-ium-2-yl)-5-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 158026318 |
| Molecular Formula | C24H30N3S+ |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-tert-butyl-4-(1-tert-butyl-3-methylbenzimidazol-3-ium-2-yl)-5-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc2sc(C(C)(C)C)nc2c1-c1n(C(C)(C)C)c2ccccc2[n+]1C |
| InChI | InChI=1S/C24H30N3S/c1-15-13-14-18-20(25-22(28-18)23(2,3)4)19(15)21-26(8)16-11-9-10-12-17(16)27(21)24(5,6)7/h9-14H,1-8H3/q+1 |
| InChIKey | YZULZWCXGBZXBB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|