C11H14N2S2 — CID 54163546
S-(2-tert-butyl-1,3-benzothiazol-4-yl)thiohydroxylamine (PubChem CID 54163546) has the molecular formula C11H14N2S2 and a molecular weight of 238.38 g/mol. Its IUPAC name is S-(2-tert-butyl-1,3-benzothiazol-4-yl)thiohydroxylamine.
| Compound Name | S-(2-tert-butyl-1,3-benzothiazol-4-yl)thiohydroxylamine |
|---|---|
| PubChem CID | 54163546 |
| Molecular Formula | C11H14N2S2 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | S-(2-tert-butyl-1,3-benzothiazol-4-yl)thiohydroxylamine |
| SMILES | CC(C)(C)c1nc2c(SN)cccc2s1 |
| InChI | InChI=1S/C11H14N2S2/c1-11(2,3)10-13-9-7(14-10)5-4-6-8(9)15-12/h4-6H,12H2,1-3H3 |
| InChIKey | OQCBLYQAIUOISY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|