C16H22N2S — CID 117439016
2-tert-butyl-4-piperidin-2-yl-1,3-benzothiazole (PubChem CID 117439016) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-tert-butyl-4-piperidin-2-yl-1,3-benzothiazole.
| Compound Name | 2-tert-butyl-4-piperidin-2-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 117439016 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-tert-butyl-4-piperidin-2-yl-1,3-benzothiazole |
| SMILES | CC(C)(C)c1nc2c(C3CCCCN3)cccc2s1 |
| InChI | InChI=1S/C16H22N2S/c1-16(2,3)15-18-14-11(7-6-9-13(14)19-15)12-8-4-5-10-17-12/h6-7,9,12,17H,4-5,8,10H2,1-3H3 |
| InChIKey | QELZMBKPPRZZID-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |