C12H16N2OS — CID 117345456
N-[(2-tert-butyl-1,3-benzothiazol-4-yl)methyl]hydroxylamine (PubChem CID 117345456) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-benzothiazol-4-yl)methyl]hydroxylamine.
| Compound Name | N-[(2-tert-butyl-1,3-benzothiazol-4-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117345456 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-[(2-tert-butyl-1,3-benzothiazol-4-yl)methyl]hydroxylamine |
| SMILES | CC(C)(C)c1nc2c(CNO)cccc2s1 |
| InChI | InChI=1S/C12H16N2OS/c1-12(2,3)11-14-10-8(7-13-15)5-4-6-9(10)16-11/h4-6,13,15H,7H2,1-3H3 |
| InChIKey | XUSLIHHRZFEGND-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|